N-(2-ethoxyphenyl)-4,6-dimethyl-2-{[2-(4-methylphenyl)-2-oxoethyl]sulfanyl}pyridine-3-carboxamide
Chemical Structure Depiction of
N-(2-ethoxyphenyl)-4,6-dimethyl-2-{[2-(4-methylphenyl)-2-oxoethyl]sulfanyl}pyridine-3-carboxamide
N-(2-ethoxyphenyl)-4,6-dimethyl-2-{[2-(4-methylphenyl)-2-oxoethyl]sulfanyl}pyridine-3-carboxamide
Compound characteristics
| Compound ID: | D276-0679 |
| Compound Name: | N-(2-ethoxyphenyl)-4,6-dimethyl-2-{[2-(4-methylphenyl)-2-oxoethyl]sulfanyl}pyridine-3-carboxamide |
| Molecular Weight: | 434.56 |
| Molecular Formula: | C25 H26 N2 O3 S |
| Smiles: | CCOc1ccccc1NC(c1c(C)cc(C)nc1SCC(c1ccc(C)cc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.4684 |
| logD: | 5.4499 |
| logSw: | -5.4448 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.371 |
| InChI Key: | RMRXPCUIYJLPBH-UHFFFAOYSA-N |