1-{4-[(2-methyl-6-phenylpyrimidin-4-yl)amino]phenyl}ethan-1-one
Chemical Structure Depiction of
1-{4-[(2-methyl-6-phenylpyrimidin-4-yl)amino]phenyl}ethan-1-one
1-{4-[(2-methyl-6-phenylpyrimidin-4-yl)amino]phenyl}ethan-1-one
Compound characteristics
| Compound ID: | D278-0527 |
| Compound Name: | 1-{4-[(2-methyl-6-phenylpyrimidin-4-yl)amino]phenyl}ethan-1-one |
| Molecular Weight: | 303.36 |
| Molecular Formula: | C19 H17 N3 O |
| Smiles: | CC(c1ccc(cc1)Nc1cc(c2ccccc2)nc(C)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0913 |
| logD: | 3.6131 |
| logSw: | -4.2654 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.457 |
| InChI Key: | MUCMFNLUJUDAGE-UHFFFAOYSA-N |