2-[3-(3,4-dimethylphenyl)-6-oxopyridazin-1(6H)-yl]-N-(4-ethoxyphenyl)butanamide
Chemical Structure Depiction of
2-[3-(3,4-dimethylphenyl)-6-oxopyridazin-1(6H)-yl]-N-(4-ethoxyphenyl)butanamide
2-[3-(3,4-dimethylphenyl)-6-oxopyridazin-1(6H)-yl]-N-(4-ethoxyphenyl)butanamide
Compound characteristics
| Compound ID: | D279-0024 |
| Compound Name: | 2-[3-(3,4-dimethylphenyl)-6-oxopyridazin-1(6H)-yl]-N-(4-ethoxyphenyl)butanamide |
| Molecular Weight: | 405.5 |
| Molecular Formula: | C24 H27 N3 O3 |
| Smiles: | CCC(C(Nc1ccc(cc1)OCC)=O)N1C(C=CC(c2ccc(C)c(C)c2)=N1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.2836 |
| logD: | 5.2836 |
| logSw: | -5.1504 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.152 |
| InChI Key: | OINARIFYQHEYLC-QFIPXVFZSA-N |