10-(5-bromo-2-hydroxyphenyl)-1,3-dimethyl-5-phenyl-1,7,8,10-tetrahydro-2H-pyrimido[4',5':3,4]pyrrolo[2,1-c][1,4]oxazine-2,4(3H)-dione
Chemical Structure Depiction of
10-(5-bromo-2-hydroxyphenyl)-1,3-dimethyl-5-phenyl-1,7,8,10-tetrahydro-2H-pyrimido[4',5':3,4]pyrrolo[2,1-c][1,4]oxazine-2,4(3H)-dione
10-(5-bromo-2-hydroxyphenyl)-1,3-dimethyl-5-phenyl-1,7,8,10-tetrahydro-2H-pyrimido[4',5':3,4]pyrrolo[2,1-c][1,4]oxazine-2,4(3H)-dione
Compound characteristics
| Compound ID: | D280-0033 |
| Compound Name: | 10-(5-bromo-2-hydroxyphenyl)-1,3-dimethyl-5-phenyl-1,7,8,10-tetrahydro-2H-pyrimido[4',5':3,4]pyrrolo[2,1-c][1,4]oxazine-2,4(3H)-dione |
| Molecular Weight: | 482.33 |
| Molecular Formula: | C23 H20 Br N3 O4 |
| Smiles: | CN1C(c2c(c3C(c4cc(ccc4O)[Br])OCCn3c2c2ccccc2)N(C)C1=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.4512 |
| logD: | 4.4472 |
| logSw: | -4.1344 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.928 |
| InChI Key: | PYNHQMLWJBPINC-OAQYLSRUSA-N |