10-(3-ethoxy-4-hydroxyphenyl)-1,3,7,7-tetramethyl-5-(4-methylphenyl)-1,7,8,10-tetrahydro-2H-pyrimido[4',5':3,4]pyrrolo[2,1-c][1,4]oxazine-2,4(3H)-dione
Chemical Structure Depiction of
10-(3-ethoxy-4-hydroxyphenyl)-1,3,7,7-tetramethyl-5-(4-methylphenyl)-1,7,8,10-tetrahydro-2H-pyrimido[4',5':3,4]pyrrolo[2,1-c][1,4]oxazine-2,4(3H)-dione
10-(3-ethoxy-4-hydroxyphenyl)-1,3,7,7-tetramethyl-5-(4-methylphenyl)-1,7,8,10-tetrahydro-2H-pyrimido[4',5':3,4]pyrrolo[2,1-c][1,4]oxazine-2,4(3H)-dione
Compound characteristics
| Compound ID: | D280-0436 |
| Compound Name: | 10-(3-ethoxy-4-hydroxyphenyl)-1,3,7,7-tetramethyl-5-(4-methylphenyl)-1,7,8,10-tetrahydro-2H-pyrimido[4',5':3,4]pyrrolo[2,1-c][1,4]oxazine-2,4(3H)-dione |
| Molecular Weight: | 489.57 |
| Molecular Formula: | C28 H31 N3 O5 |
| Smiles: | CCOc1cc(ccc1O)C1c2c3c(C(N(C)C(N3C)=O)=O)c(c3ccc(C)cc3)n2C(C)(C)CO1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.5243 |
| logD: | 4.5224 |
| logSw: | -4.1868 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.061 |
| InChI Key: | QSNCGYKTUNFDFZ-RUZDIDTESA-N |