4-methyl-2-phenyl-N-[3-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide
Chemical Structure Depiction of
4-methyl-2-phenyl-N-[3-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide
4-methyl-2-phenyl-N-[3-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide
Compound characteristics
| Compound ID: | D282-0096 |
| Compound Name: | 4-methyl-2-phenyl-N-[3-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide |
| Molecular Weight: | 362.37 |
| Molecular Formula: | C18 H13 F3 N2 O S |
| Smiles: | Cc1c(C(Nc2cccc(c2)C(F)(F)F)=O)sc(c2ccccc2)n1 |
| Stereo: | ACHIRAL |
| logP: | 5.319 |
| logD: | 5.3098 |
| logSw: | -5.4898 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.64 |
| InChI Key: | JGMIRTIZBRGPGB-UHFFFAOYSA-N |