2-(1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-9H-purin-9-yl)-N-[2-(5-methylfuran-2-yl)phenyl]acetamide
Chemical Structure Depiction of
2-(1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-9H-purin-9-yl)-N-[2-(5-methylfuran-2-yl)phenyl]acetamide
2-(1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-9H-purin-9-yl)-N-[2-(5-methylfuran-2-yl)phenyl]acetamide
Compound characteristics
| Compound ID: | D283-0107 |
| Compound Name: | 2-(1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-9H-purin-9-yl)-N-[2-(5-methylfuran-2-yl)phenyl]acetamide |
| Molecular Weight: | 393.4 |
| Molecular Formula: | C20 H19 N5 O4 |
| Smiles: | Cc1ccc(c2ccccc2NC(Cn2cnc3C(N(C)C(N(C)c23)=O)=O)=O)o1 |
| Stereo: | ACHIRAL |
| logP: | 2.0966 |
| logD: | 2.0966 |
| logSw: | -3.1054 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.176 |
| InChI Key: | VILUAVSPZVIQQY-UHFFFAOYSA-N |