N-[4-(5-{[(4-fluorophenyl)methyl]sulfanyl}-4-phenyl-4H-1,2,4-triazol-3-yl)-1,2,5-oxadiazol-3-yl]acetamide
Chemical Structure Depiction of
N-[4-(5-{[(4-fluorophenyl)methyl]sulfanyl}-4-phenyl-4H-1,2,4-triazol-3-yl)-1,2,5-oxadiazol-3-yl]acetamide
N-[4-(5-{[(4-fluorophenyl)methyl]sulfanyl}-4-phenyl-4H-1,2,4-triazol-3-yl)-1,2,5-oxadiazol-3-yl]acetamide
Compound characteristics
| Compound ID: | D291-0274 |
| Compound Name: | N-[4-(5-{[(4-fluorophenyl)methyl]sulfanyl}-4-phenyl-4H-1,2,4-triazol-3-yl)-1,2,5-oxadiazol-3-yl]acetamide |
| Molecular Weight: | 410.43 |
| Molecular Formula: | C19 H15 F N6 O2 S |
| Smiles: | CC(Nc1c(c2nnc(n2c2ccccc2)SCc2ccc(cc2)F)non1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2272 |
| logD: | 3.2268 |
| logSw: | -3.4193 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 85.003 |
| InChI Key: | NXQMQTGSOVDGAP-UHFFFAOYSA-N |