5-{[(4-ethylphenyl)methyl][(furan-2-yl)methyl]amino}-2-(methanesulfonyl)-N-(4-methylphenyl)pyrimidine-4-carboxamide
Chemical Structure Depiction of
5-{[(4-ethylphenyl)methyl][(furan-2-yl)methyl]amino}-2-(methanesulfonyl)-N-(4-methylphenyl)pyrimidine-4-carboxamide
5-{[(4-ethylphenyl)methyl][(furan-2-yl)methyl]amino}-2-(methanesulfonyl)-N-(4-methylphenyl)pyrimidine-4-carboxamide
Compound characteristics
| Compound ID: | D299-0621 |
| Compound Name: | 5-{[(4-ethylphenyl)methyl][(furan-2-yl)methyl]amino}-2-(methanesulfonyl)-N-(4-methylphenyl)pyrimidine-4-carboxamide |
| Molecular Weight: | 504.61 |
| Molecular Formula: | C27 H28 N4 O4 S |
| Smiles: | [H]N(C(c1c(cnc(n1)S(C)(=O)=O)N(Cc1ccc(CC)cc1)Cc1ccco1)=O)c1ccc(C)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.7833 |
| logD: | 4.7821 |
| logSw: | -4.3466 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 82.683 |
| InChI Key: | ILOWQWVXEGHIBE-UHFFFAOYSA-N |