5-[4-(4-methoxyphenyl)piperazin-1-yl]-2-{5-[(3-methylphenoxy)methyl]furan-2-yl}-1,3-oxazole-4-carbonitrile
Chemical Structure Depiction of
5-[4-(4-methoxyphenyl)piperazin-1-yl]-2-{5-[(3-methylphenoxy)methyl]furan-2-yl}-1,3-oxazole-4-carbonitrile
5-[4-(4-methoxyphenyl)piperazin-1-yl]-2-{5-[(3-methylphenoxy)methyl]furan-2-yl}-1,3-oxazole-4-carbonitrile
Compound characteristics
| Compound ID: | D301-0222 |
| Compound Name: | 5-[4-(4-methoxyphenyl)piperazin-1-yl]-2-{5-[(3-methylphenoxy)methyl]furan-2-yl}-1,3-oxazole-4-carbonitrile |
| Molecular Weight: | 470.53 |
| Molecular Formula: | C27 H26 N4 O4 |
| Smiles: | Cc1cccc(c1)OCc1ccc(c2nc(C#N)c(N3CCN(CC3)c3ccc(cc3)OC)o2)o1 |
| Stereo: | ACHIRAL |
| logP: | 5.5201 |
| logD: | 5.5199 |
| logSw: | -5.552 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 65.628 |
| InChI Key: | QLDIMVWIYQHXPP-UHFFFAOYSA-N |