N-(2-{[4-(4-chlorobenzoyl)piperazin-1-yl]methyl}-1-methyl-1H-benzimidazol-5-yl)pentanamide
Chemical Structure Depiction of
N-(2-{[4-(4-chlorobenzoyl)piperazin-1-yl]methyl}-1-methyl-1H-benzimidazol-5-yl)pentanamide
N-(2-{[4-(4-chlorobenzoyl)piperazin-1-yl]methyl}-1-methyl-1H-benzimidazol-5-yl)pentanamide
Compound characteristics
| Compound ID: | D305-0578 |
| Compound Name: | N-(2-{[4-(4-chlorobenzoyl)piperazin-1-yl]methyl}-1-methyl-1H-benzimidazol-5-yl)pentanamide |
| Molecular Weight: | 468 |
| Molecular Formula: | C25 H30 Cl N5 O2 |
| Smiles: | CCCCC(Nc1ccc2c(c1)nc(CN1CCN(CC1)C(c1ccc(cc1)[Cl])=O)n2C)=O |
| Stereo: | ACHIRAL |
| logP: | 3.367 |
| logD: | 2.7728 |
| logSw: | -3.8263 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.563 |
| InChI Key: | FCIWGVINCNYLFE-UHFFFAOYSA-N |