N-{1-ethyl-2-[(4-methylpiperidin-1-yl)methyl]-1H-benzimidazol-5-yl}-2-methoxybenzamide
Chemical Structure Depiction of
N-{1-ethyl-2-[(4-methylpiperidin-1-yl)methyl]-1H-benzimidazol-5-yl}-2-methoxybenzamide
N-{1-ethyl-2-[(4-methylpiperidin-1-yl)methyl]-1H-benzimidazol-5-yl}-2-methoxybenzamide
Compound characteristics
| Compound ID: | D305-1286 |
| Compound Name: | N-{1-ethyl-2-[(4-methylpiperidin-1-yl)methyl]-1H-benzimidazol-5-yl}-2-methoxybenzamide |
| Molecular Weight: | 406.53 |
| Molecular Formula: | C24 H30 N4 O2 |
| Smiles: | CCn1c2ccc(cc2nc1CN1CCC(C)CC1)NC(c1ccccc1OC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1593 |
| logD: | 4.0106 |
| logSw: | -4.1914 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.594 |
| InChI Key: | NTKKWRHSSXVGDW-UHFFFAOYSA-N |