ethyl 4-{[5-(4-tert-butylbenzamido)-1-ethyl-1H-benzimidazol-2-yl]methyl}piperazine-1-carboxylate
Chemical Structure Depiction of
ethyl 4-{[5-(4-tert-butylbenzamido)-1-ethyl-1H-benzimidazol-2-yl]methyl}piperazine-1-carboxylate
ethyl 4-{[5-(4-tert-butylbenzamido)-1-ethyl-1H-benzimidazol-2-yl]methyl}piperazine-1-carboxylate
Compound characteristics
| Compound ID: | D305-2893 |
| Compound Name: | ethyl 4-{[5-(4-tert-butylbenzamido)-1-ethyl-1H-benzimidazol-2-yl]methyl}piperazine-1-carboxylate |
| Molecular Weight: | 491.63 |
| Molecular Formula: | C28 H37 N5 O3 |
| Smiles: | CCn1c2ccc(cc2nc1CN1CCN(CC1)C(=O)OCC)NC(c1ccc(cc1)C(C)(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2642 |
| logD: | 5.2582 |
| logSw: | -5.0313 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.743 |
| InChI Key: | SMNTYFBFFZKOSR-UHFFFAOYSA-N |