2-[(2,6-dimethylpyrimidin-4-yl)sulfanyl]-N-(4-ethoxyphenyl)acetamide
Chemical Structure Depiction of
2-[(2,6-dimethylpyrimidin-4-yl)sulfanyl]-N-(4-ethoxyphenyl)acetamide
2-[(2,6-dimethylpyrimidin-4-yl)sulfanyl]-N-(4-ethoxyphenyl)acetamide
Compound characteristics
| Compound ID: | D306-0062 |
| Compound Name: | 2-[(2,6-dimethylpyrimidin-4-yl)sulfanyl]-N-(4-ethoxyphenyl)acetamide |
| Molecular Weight: | 317.41 |
| Molecular Formula: | C16 H19 N3 O2 S |
| Smiles: | CCOc1ccc(cc1)NC(CSc1cc(C)nc(C)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8358 |
| logD: | 2.8349 |
| logSw: | -3.2961 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.591 |
| InChI Key: | XNTWYJBSKHNJSV-UHFFFAOYSA-N |