N-(4-ethoxyphenyl)-2-[(6-methylpyrimidin-4-yl)sulfanyl]propanamide
Chemical Structure Depiction of
N-(4-ethoxyphenyl)-2-[(6-methylpyrimidin-4-yl)sulfanyl]propanamide
N-(4-ethoxyphenyl)-2-[(6-methylpyrimidin-4-yl)sulfanyl]propanamide
Compound characteristics
| Compound ID: | D306-0505 |
| Compound Name: | N-(4-ethoxyphenyl)-2-[(6-methylpyrimidin-4-yl)sulfanyl]propanamide |
| Molecular Weight: | 317.41 |
| Molecular Formula: | C16 H19 N3 O2 S |
| Smiles: | CCOc1ccc(cc1)NC(C(C)Sc1cc(C)ncn1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2155 |
| logD: | 3.2154 |
| logSw: | -3.409 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.431 |
| InChI Key: | ZQGKDTVJPNBTTM-LBPRGKRZSA-N |