N-(2-methoxyphenyl)-2-[(5-methyl[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propanamide
Chemical Structure Depiction of
N-(2-methoxyphenyl)-2-[(5-methyl[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propanamide
N-(2-methoxyphenyl)-2-[(5-methyl[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propanamide
Compound characteristics
| Compound ID: | D308-0329 |
| Compound Name: | N-(2-methoxyphenyl)-2-[(5-methyl[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propanamide |
| Molecular Weight: | 392.48 |
| Molecular Formula: | C21 H20 N4 O2 S |
| Smiles: | CC(C(Nc1ccccc1OC)=O)Sc1nnc2cc(C)c3ccccc3n12 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.448 |
| logD: | 4.4479 |
| logSw: | -4.3338 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.377 |
| InChI Key: | ANMDKGNDZQTDOX-AWEZNQCLSA-N |