N-(4-acetamidophenyl)-2,4-dimethyl-1,3-thiazole-5-carboxamide
Chemical Structure Depiction of
N-(4-acetamidophenyl)-2,4-dimethyl-1,3-thiazole-5-carboxamide
N-(4-acetamidophenyl)-2,4-dimethyl-1,3-thiazole-5-carboxamide
Compound characteristics
| Compound ID: | D308-0527 |
| Compound Name: | N-(4-acetamidophenyl)-2,4-dimethyl-1,3-thiazole-5-carboxamide |
| Molecular Weight: | 289.35 |
| Molecular Formula: | C14 H15 N3 O2 S |
| Smiles: | CC(Nc1ccc(cc1)NC(c1c(C)nc(C)s1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9435 |
| logD: | 1.9433 |
| logSw: | -2.5746 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.98 |
| InChI Key: | CBLPFZFYZDXMTK-UHFFFAOYSA-N |