N-[4-(dimethylamino)phenyl]-2-{4-[(4-methoxyphenyl)methyl]-3,5-dimethyl-1H-pyrazol-1-yl}-4-methyl-1,3-thiazole-5-carboxamide
Chemical Structure Depiction of
N-[4-(dimethylamino)phenyl]-2-{4-[(4-methoxyphenyl)methyl]-3,5-dimethyl-1H-pyrazol-1-yl}-4-methyl-1,3-thiazole-5-carboxamide
N-[4-(dimethylamino)phenyl]-2-{4-[(4-methoxyphenyl)methyl]-3,5-dimethyl-1H-pyrazol-1-yl}-4-methyl-1,3-thiazole-5-carboxamide
Compound characteristics
| Compound ID: | D314-0429 |
| Compound Name: | N-[4-(dimethylamino)phenyl]-2-{4-[(4-methoxyphenyl)methyl]-3,5-dimethyl-1H-pyrazol-1-yl}-4-methyl-1,3-thiazole-5-carboxamide |
| Molecular Weight: | 475.61 |
| Molecular Formula: | C26 H29 N5 O2 S |
| Smiles: | Cc1c(C(Nc2ccc(cc2)N(C)C)=O)sc(n1)n1c(C)c(Cc2ccc(cc2)OC)c(C)n1 |
| Stereo: | ACHIRAL |
| logP: | 5.0454 |
| logD: | 5.0366 |
| logSw: | -4.6675 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.222 |
| InChI Key: | HWDROYPXWHPWAI-UHFFFAOYSA-N |