N-(2,6-dimethylphenyl)-2-{3-[4-methyl-3-(piperidine-1-sulfonyl)phenyl]-6-oxopyridazin-1(6H)-yl}acetamide
Chemical Structure Depiction of
N-(2,6-dimethylphenyl)-2-{3-[4-methyl-3-(piperidine-1-sulfonyl)phenyl]-6-oxopyridazin-1(6H)-yl}acetamide
N-(2,6-dimethylphenyl)-2-{3-[4-methyl-3-(piperidine-1-sulfonyl)phenyl]-6-oxopyridazin-1(6H)-yl}acetamide
Compound characteristics
| Compound ID: | D315-1449 |
| Compound Name: | N-(2,6-dimethylphenyl)-2-{3-[4-methyl-3-(piperidine-1-sulfonyl)phenyl]-6-oxopyridazin-1(6H)-yl}acetamide |
| Molecular Weight: | 494.61 |
| Molecular Formula: | C26 H30 N4 O4 S |
| Smiles: | Cc1ccc(cc1S(N1CCCCC1)(=O)=O)C1C=CC(N(CC(Nc2c(C)cccc2C)=O)N=1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7725 |
| logD: | 3.7725 |
| logSw: | -3.8803 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 82.012 |
| InChI Key: | YRAIGGWVHQMQDU-UHFFFAOYSA-N |