N-(4-chlorophenyl)-2-methyl-5-(6-oxo-1,6-dihydropyridazin-3-yl)benzene-1-sulfonamide
Chemical Structure Depiction of
N-(4-chlorophenyl)-2-methyl-5-(6-oxo-1,6-dihydropyridazin-3-yl)benzene-1-sulfonamide
N-(4-chlorophenyl)-2-methyl-5-(6-oxo-1,6-dihydropyridazin-3-yl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | D315-1657 |
| Compound Name: | N-(4-chlorophenyl)-2-methyl-5-(6-oxo-1,6-dihydropyridazin-3-yl)benzene-1-sulfonamide |
| Molecular Weight: | 375.83 |
| Molecular Formula: | C17 H14 Cl N3 O3 S |
| Smiles: | Cc1ccc(cc1S(Nc1ccc(cc1)[Cl])(=O)=O)C1C=CC(NN=1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.921 |
| logD: | 2.7968 |
| logSw: | -4.3897 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 78.025 |
| InChI Key: | ZIYKLPHUWIGADY-UHFFFAOYSA-N |