N-[5-(benzylsulfanyl)-1,3,4-thiadiazol-2-yl]-4-methyl-1,2,3-thiadiazole-5-carboxamide
Chemical Structure Depiction of
N-[5-(benzylsulfanyl)-1,3,4-thiadiazol-2-yl]-4-methyl-1,2,3-thiadiazole-5-carboxamide
N-[5-(benzylsulfanyl)-1,3,4-thiadiazol-2-yl]-4-methyl-1,2,3-thiadiazole-5-carboxamide
Compound characteristics
| Compound ID: | D319-0339 |
| Compound Name: | N-[5-(benzylsulfanyl)-1,3,4-thiadiazol-2-yl]-4-methyl-1,2,3-thiadiazole-5-carboxamide |
| Molecular Weight: | 349.45 |
| Molecular Formula: | C13 H11 N5 O S3 |
| Smiles: | [H]N(C(c1c(C)nns1)=O)c1nnc(SCc2ccccc2)s1 |
| Stereo: | ACHIRAL |
| logP: | 3.0906 |
| logD: | 2.7822 |
| logSw: | -3.358 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.407 |
| InChI Key: | VTWOYQKZNJIWEK-UHFFFAOYSA-N |