N-(5-chloro-2-methylphenyl)-4-methyl-1,2,3-thiadiazole-5-carboxamide
Chemical Structure Depiction of
N-(5-chloro-2-methylphenyl)-4-methyl-1,2,3-thiadiazole-5-carboxamide
N-(5-chloro-2-methylphenyl)-4-methyl-1,2,3-thiadiazole-5-carboxamide
Compound characteristics
| Compound ID: | D319-0739 |
| Compound Name: | N-(5-chloro-2-methylphenyl)-4-methyl-1,2,3-thiadiazole-5-carboxamide |
| Molecular Weight: | 267.73 |
| Molecular Formula: | C11 H10 Cl N3 O S |
| Smiles: | [H]N(C(c1c(C)nns1)=O)c1cc(ccc1C)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 2.5548 |
| logD: | 2.4787 |
| logSw: | -3.487 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.075 |
| InChI Key: | OGIFKZQWPXIOGI-UHFFFAOYSA-N |