1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-[3-(thiophen-2-yl)-1,2,4-oxadiazol-5-yl]propan-1-one
Chemical Structure Depiction of
1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-[3-(thiophen-2-yl)-1,2,4-oxadiazol-5-yl]propan-1-one
1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-[3-(thiophen-2-yl)-1,2,4-oxadiazol-5-yl]propan-1-one
Compound characteristics
| Compound ID: | D320-0594 |
| Compound Name: | 1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-[3-(thiophen-2-yl)-1,2,4-oxadiazol-5-yl]propan-1-one |
| Molecular Weight: | 398.48 |
| Molecular Formula: | C20 H22 N4 O3 S |
| Smiles: | COc1ccc(cc1)N1CCN(CC1)C(CCc1nc(c2cccs2)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3971 |
| logD: | 3.3967 |
| logSw: | -3.6064 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 59.525 |
| InChI Key: | KUPOCADVRCCDTI-UHFFFAOYSA-N |