N-[3-(thiophen-2-yl)-1,2,4-thiadiazol-5-yl]furan-2-carboxamide
Chemical Structure Depiction of
N-[3-(thiophen-2-yl)-1,2,4-thiadiazol-5-yl]furan-2-carboxamide
N-[3-(thiophen-2-yl)-1,2,4-thiadiazol-5-yl]furan-2-carboxamide
Compound characteristics
| Compound ID: | D323-0136 |
| Compound Name: | N-[3-(thiophen-2-yl)-1,2,4-thiadiazol-5-yl]furan-2-carboxamide |
| Molecular Weight: | 277.32 |
| Molecular Formula: | C11 H7 N3 O2 S2 |
| Smiles: | c1cc(C(Nc2nc(c3cccs3)ns2)=O)oc1 |
| Stereo: | ACHIRAL |
| logP: | 3.0737 |
| logD: | 3.0707 |
| logSw: | -3.4157 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.514 |
| InChI Key: | UGINQXPLLZGLCC-UHFFFAOYSA-N |