3-[(3-methoxyphenyl)methyl]-1,3-dihydro-2H-indol-2-one
					Chemical Structure Depiction of
3-[(3-methoxyphenyl)methyl]-1,3-dihydro-2H-indol-2-one
			3-[(3-methoxyphenyl)methyl]-1,3-dihydro-2H-indol-2-one
Compound characteristics
| Compound ID: | D330-0037 | 
| Compound Name: | 3-[(3-methoxyphenyl)methyl]-1,3-dihydro-2H-indol-2-one | 
| Molecular Weight: | 253.3 | 
| Molecular Formula: | C16 H15 N O2 | 
| Smiles: | COc1cccc(CC2C(Nc3ccccc23)=O)c1 | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 3.3913 | 
| logD: | 3.3912 | 
| logSw: | -3.7594 | 
| Hydrogen bond acceptors count: | 3 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 32.754 | 
| InChI Key: | HTCZUIWPAZEALN-AWEZNQCLSA-N | 
 
				 
				