5-chloro-3-{[4-(methylsulfanyl)phenyl]methyl}-1,3-dihydro-2H-indol-2-one
Chemical Structure Depiction of
5-chloro-3-{[4-(methylsulfanyl)phenyl]methyl}-1,3-dihydro-2H-indol-2-one
5-chloro-3-{[4-(methylsulfanyl)phenyl]methyl}-1,3-dihydro-2H-indol-2-one
Compound characteristics
| Compound ID: | D330-0290 |
| Compound Name: | 5-chloro-3-{[4-(methylsulfanyl)phenyl]methyl}-1,3-dihydro-2H-indol-2-one |
| Molecular Weight: | 303.81 |
| Molecular Formula: | C16 H14 Cl N O S |
| Smiles: | CSc1ccc(CC2C(Nc3ccc(cc23)[Cl])=O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7364 |
| logD: | 4.7334 |
| logSw: | -4.7706 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 25.2104 |
| InChI Key: | FEUORKGSRAKDTF-AWEZNQCLSA-N |