5-bromo-1-methyl-3-[(3-methylthiophen-2-yl)methyl]-1,3-dihydro-2H-indol-2-one
Chemical Structure Depiction of
5-bromo-1-methyl-3-[(3-methylthiophen-2-yl)methyl]-1,3-dihydro-2H-indol-2-one
5-bromo-1-methyl-3-[(3-methylthiophen-2-yl)methyl]-1,3-dihydro-2H-indol-2-one
Compound characteristics
| Compound ID: | D330-1686 |
| Compound Name: | 5-bromo-1-methyl-3-[(3-methylthiophen-2-yl)methyl]-1,3-dihydro-2H-indol-2-one |
| Molecular Weight: | 336.25 |
| Molecular Formula: | C15 H14 Br N O S |
| Smiles: | Cc1ccsc1CC1C(N(C)c2ccc(cc12)[Br])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.0534 |
| logD: | 4.0529 |
| logSw: | -4.2354 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 16.4911 |
| InChI Key: | JAVIDZZTOYBASM-LBPRGKRZSA-N |