[5-{[(3-bromophenyl)methyl]amino}-3-(furan-2-yl)-1H-1,2,4-triazol-1-yl](naphthalen-1-yl)methanone
Chemical Structure Depiction of
[5-{[(3-bromophenyl)methyl]amino}-3-(furan-2-yl)-1H-1,2,4-triazol-1-yl](naphthalen-1-yl)methanone
[5-{[(3-bromophenyl)methyl]amino}-3-(furan-2-yl)-1H-1,2,4-triazol-1-yl](naphthalen-1-yl)methanone
Compound characteristics
| Compound ID: | D331-0388 |
| Compound Name: | [5-{[(3-bromophenyl)methyl]amino}-3-(furan-2-yl)-1H-1,2,4-triazol-1-yl](naphthalen-1-yl)methanone |
| Molecular Weight: | 473.33 |
| Molecular Formula: | C24 H17 Br N4 O2 |
| Smiles: | C(c1cccc(c1)[Br])Nc1nc(c2ccco2)nn1C(c1cccc2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1418 |
| logD: | 5.1418 |
| logSw: | -6.2487 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.534 |
| InChI Key: | OLGUYOHTQXRDCR-UHFFFAOYSA-N |