[3-(furan-2-yl)-5-({[4-(propan-2-yl)phenyl]methyl}amino)-1H-1,2,4-triazol-1-yl](4-methylphenyl)methanone
Chemical Structure Depiction of
[3-(furan-2-yl)-5-({[4-(propan-2-yl)phenyl]methyl}amino)-1H-1,2,4-triazol-1-yl](4-methylphenyl)methanone
[3-(furan-2-yl)-5-({[4-(propan-2-yl)phenyl]methyl}amino)-1H-1,2,4-triazol-1-yl](4-methylphenyl)methanone
Compound characteristics
| Compound ID: | D331-0471 |
| Compound Name: | [3-(furan-2-yl)-5-({[4-(propan-2-yl)phenyl]methyl}amino)-1H-1,2,4-triazol-1-yl](4-methylphenyl)methanone |
| Molecular Weight: | 400.48 |
| Molecular Formula: | C24 H24 N4 O2 |
| Smiles: | CC(C)c1ccc(CNc2nc(c3ccco3)nn2C(c2ccc(C)cc2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.198 |
| logD: | 5.198 |
| logSw: | -5.0909 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.806 |
| InChI Key: | IDMYZWMRCMVNFP-UHFFFAOYSA-N |