5-bromo-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]furan-2-carboxamide
Chemical Structure Depiction of
5-bromo-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]furan-2-carboxamide
5-bromo-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]furan-2-carboxamide
Compound characteristics
| Compound ID: | D335-1238 |
| Compound Name: | 5-bromo-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]furan-2-carboxamide |
| Molecular Weight: | 363.23 |
| Molecular Formula: | C15 H11 Br N2 O2 S |
| Smiles: | [H]N(Cc1csc(c2ccccc2)n1)C(c1ccc(o1)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 3.9616 |
| logD: | 3.9615 |
| logSw: | -4.2391 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.807 |
| InChI Key: | UZSQFCMYKFNUOY-UHFFFAOYSA-N |