2-(4-methoxyphenoxy)-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]acetamide
Chemical Structure Depiction of
2-(4-methoxyphenoxy)-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]acetamide
2-(4-methoxyphenoxy)-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]acetamide
Compound characteristics
| Compound ID: | D335-2982 |
| Compound Name: | 2-(4-methoxyphenoxy)-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]acetamide |
| Molecular Weight: | 368.45 |
| Molecular Formula: | C20 H20 N2 O3 S |
| Smiles: | [H]N(CCc1csc(c2ccccc2)n1)C(COc1ccc(cc1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.548 |
| logD: | 3.548 |
| logSw: | -3.7275 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.552 |
| InChI Key: | GWDLMJADHAPXQG-UHFFFAOYSA-N |