5-phenyl-N-[4-(phenyldiazenyl)phenyl]-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
5-phenyl-N-[4-(phenyldiazenyl)phenyl]-1,2-oxazole-3-carboxamide
5-phenyl-N-[4-(phenyldiazenyl)phenyl]-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | D337-0087 |
| Compound Name: | 5-phenyl-N-[4-(phenyldiazenyl)phenyl]-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 368.39 |
| Molecular Formula: | C22 H16 N4 O2 |
| Smiles: | [H]N(C(c1cc(c2ccccc2)on1)=O)c1ccc(cc1)/N=N/c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 5.7146 |
| logD: | 5.7146 |
| logSw: | -5.8671 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.552 |
| InChI Key: | RZKRDXSVMHTLKE-UHFFFAOYSA-N |