butyl 4-{[5-(4-chlorophenyl)-1,2-oxazole-3-carbonyl]amino}benzoate
Chemical Structure Depiction of
butyl 4-{[5-(4-chlorophenyl)-1,2-oxazole-3-carbonyl]amino}benzoate
butyl 4-{[5-(4-chlorophenyl)-1,2-oxazole-3-carbonyl]amino}benzoate
Compound characteristics
| Compound ID: | D337-0781 |
| Compound Name: | butyl 4-{[5-(4-chlorophenyl)-1,2-oxazole-3-carbonyl]amino}benzoate |
| Molecular Weight: | 398.84 |
| Molecular Formula: | C21 H19 Cl N2 O4 |
| Smiles: | [H]N(C(c1cc(c2ccc(cc2)[Cl])on1)=O)c1ccc(cc1)C(=O)OCCCC |
| Stereo: | ACHIRAL |
| logP: | 6.0126 |
| logD: | 6.0125 |
| logSw: | -6.1763 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.913 |
| InChI Key: | ZEDZRNNCDCEGMB-UHFFFAOYSA-N |