5-(4-chlorophenyl)-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
5-(4-chlorophenyl)-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1,2-oxazole-3-carboxamide
5-(4-chlorophenyl)-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | D337-0888 |
| Compound Name: | 5-(4-chlorophenyl)-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 320.75 |
| Molecular Formula: | C13 H9 Cl N4 O2 S |
| Smiles: | [H]N(C(c1cc(c2ccc(cc2)[Cl])on1)=O)c1nnc(C)s1 |
| Stereo: | ACHIRAL |
| logP: | 3.3534 |
| logD: | 3.2681 |
| logSw: | -3.9335 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.216 |
| InChI Key: | QQKRVMKDUULNSU-UHFFFAOYSA-N |