5-(4-chlorophenyl)-N-[2-(4-sulfamoylphenyl)ethyl]-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
5-(4-chlorophenyl)-N-[2-(4-sulfamoylphenyl)ethyl]-1,2-oxazole-3-carboxamide
5-(4-chlorophenyl)-N-[2-(4-sulfamoylphenyl)ethyl]-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | D337-0899 |
| Compound Name: | 5-(4-chlorophenyl)-N-[2-(4-sulfamoylphenyl)ethyl]-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 405.86 |
| Molecular Formula: | C18 H16 Cl N3 O4 S |
| Smiles: | [H]N(CCc1ccc(cc1)S(N)(=O)=O)C(c1cc(c2ccc(cc2)[Cl])on1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.4641 |
| logD: | 2.4634 |
| logSw: | -3.6214 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 96.632 |
| InChI Key: | BSTYQKPPTJVEEE-UHFFFAOYSA-N |