5-(4-chlorophenyl)-N-{[4-(dimethylamino)phenyl]methyl}-N-[(furan-2-yl)methyl]-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
5-(4-chlorophenyl)-N-{[4-(dimethylamino)phenyl]methyl}-N-[(furan-2-yl)methyl]-1,2-oxazole-3-carboxamide
5-(4-chlorophenyl)-N-{[4-(dimethylamino)phenyl]methyl}-N-[(furan-2-yl)methyl]-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | D337-0931 |
| Compound Name: | 5-(4-chlorophenyl)-N-{[4-(dimethylamino)phenyl]methyl}-N-[(furan-2-yl)methyl]-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 435.91 |
| Molecular Formula: | C24 H22 Cl N3 O3 |
| Smiles: | CN(C)c1ccc(CN(Cc2ccco2)C(c2cc(c3ccc(cc3)[Cl])on2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.2839 |
| logD: | 5.2685 |
| logSw: | -5.9619 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 48.267 |
| InChI Key: | QPRWHIVOIRUFEK-UHFFFAOYSA-N |