methyl 2-{[5-(3,4-dimethylphenyl)-1,2-oxazole-3-carbonyl]amino}benzoate
Chemical Structure Depiction of
methyl 2-{[5-(3,4-dimethylphenyl)-1,2-oxazole-3-carbonyl]amino}benzoate
methyl 2-{[5-(3,4-dimethylphenyl)-1,2-oxazole-3-carbonyl]amino}benzoate
Compound characteristics
| Compound ID: | D337-1448 |
| Compound Name: | methyl 2-{[5-(3,4-dimethylphenyl)-1,2-oxazole-3-carbonyl]amino}benzoate |
| Molecular Weight: | 350.37 |
| Molecular Formula: | C20 H18 N2 O4 |
| Smiles: | [H]N(C(c1cc(c2ccc(C)c(C)c2)on1)=O)c1ccccc1C(=O)OC |
| Stereo: | ACHIRAL |
| logP: | 4.6453 |
| logD: | 4.621 |
| logSw: | -4.429 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.341 |
| InChI Key: | JZMIGZNAIMLXEF-UHFFFAOYSA-N |