N-[4-(2-ethylpiperidine-1-sulfonyl)phenyl]-5-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
N-[4-(2-ethylpiperidine-1-sulfonyl)phenyl]-5-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide
N-[4-(2-ethylpiperidine-1-sulfonyl)phenyl]-5-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | D337-1849 |
| Compound Name: | N-[4-(2-ethylpiperidine-1-sulfonyl)phenyl]-5-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 469.56 |
| Molecular Formula: | C24 H27 N3 O5 S |
| Smiles: | [H]N(C(c1cc(c2ccc(cc2)OC)on1)=O)c1ccc(cc1)S(N1CCCCC1CC)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7169 |
| logD: | 4.716 |
| logSw: | -4.4416 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 84.543 |
| InChI Key: | NXAUVDVQAIJZOI-IBGZPJMESA-N |