N-(6-fluoro-1,3-benzothiazol-2-yl)-5-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
N-(6-fluoro-1,3-benzothiazol-2-yl)-5-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide
N-(6-fluoro-1,3-benzothiazol-2-yl)-5-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | D337-1898 |
| Compound Name: | N-(6-fluoro-1,3-benzothiazol-2-yl)-5-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 369.37 |
| Molecular Formula: | C18 H12 F N3 O3 S |
| Smiles: | COc1ccc(cc1)c1cc(C(Nc2nc3ccc(cc3s2)F)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 4.7332 |
| logD: | 4.7331 |
| logSw: | -4.6072 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.17 |
| InChI Key: | SHIDMHPEMZJLTR-UHFFFAOYSA-N |