ethyl 2-{[5-(4-ethoxyphenyl)-1,2-oxazole-3-carbonyl]amino}-4-phenylthiophene-3-carboxylate
Chemical Structure Depiction of
ethyl 2-{[5-(4-ethoxyphenyl)-1,2-oxazole-3-carbonyl]amino}-4-phenylthiophene-3-carboxylate
ethyl 2-{[5-(4-ethoxyphenyl)-1,2-oxazole-3-carbonyl]amino}-4-phenylthiophene-3-carboxylate
Compound characteristics
| Compound ID: | D337-2047 |
| Compound Name: | ethyl 2-{[5-(4-ethoxyphenyl)-1,2-oxazole-3-carbonyl]amino}-4-phenylthiophene-3-carboxylate |
| Molecular Weight: | 462.52 |
| Molecular Formula: | C25 H22 N2 O5 S |
| Smiles: | [H]N(C(c1cc(c2ccc(cc2)OCC)on1)=O)c1c(C(=O)OCC)c(cs1)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 5.7415 |
| logD: | 5.7212 |
| logSw: | -5.5291 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 72.265 |
| InChI Key: | JTCHYRSCCCAFPI-UHFFFAOYSA-N |