ethyl 5-acetyl-2-{[5-(4-ethoxyphenyl)-1,2-oxazole-3-carbonyl]amino}-4-methylthiophene-3-carboxylate
Chemical Structure Depiction of
ethyl 5-acetyl-2-{[5-(4-ethoxyphenyl)-1,2-oxazole-3-carbonyl]amino}-4-methylthiophene-3-carboxylate
ethyl 5-acetyl-2-{[5-(4-ethoxyphenyl)-1,2-oxazole-3-carbonyl]amino}-4-methylthiophene-3-carboxylate
Compound characteristics
| Compound ID: | D337-2050 |
| Compound Name: | ethyl 5-acetyl-2-{[5-(4-ethoxyphenyl)-1,2-oxazole-3-carbonyl]amino}-4-methylthiophene-3-carboxylate |
| Molecular Weight: | 442.49 |
| Molecular Formula: | C22 H22 N2 O6 S |
| Smiles: | [H]N(C(c1cc(c2ccc(cc2)OCC)on1)=O)c1c(C(=O)OCC)c(C)c(C(C)=O)s1 |
| Stereo: | ACHIRAL |
| logP: | 4.1845 |
| logD: | 1.3341 |
| logSw: | -4.3335 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 86.363 |
| InChI Key: | LAWZWTWZFNTYQU-UHFFFAOYSA-N |