5-(4-ethoxyphenyl)-N-(3-{[(oxolan-2-yl)methyl]carbamoyl}-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
5-(4-ethoxyphenyl)-N-(3-{[(oxolan-2-yl)methyl]carbamoyl}-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-1,2-oxazole-3-carboxamide
5-(4-ethoxyphenyl)-N-(3-{[(oxolan-2-yl)methyl]carbamoyl}-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | D337-2070 |
| Compound Name: | 5-(4-ethoxyphenyl)-N-(3-{[(oxolan-2-yl)methyl]carbamoyl}-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 481.57 |
| Molecular Formula: | C25 H27 N3 O5 S |
| Smiles: | [H]N(C(c1cc(c2ccc(cc2)OCC)on1)=O)c1c(C(NCC2CCCO2)=O)c2CCCc2s1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9012 |
| logD: | 3.0492 |
| logSw: | -4.2385 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 85.137 |
| InChI Key: | YJKQSVXLSKYHAV-QGZVFWFLSA-N |