2-ethoxy-N-(4-methylphenyl)-N-[(thiophen-2-yl)methyl]benzamide
Chemical Structure Depiction of
2-ethoxy-N-(4-methylphenyl)-N-[(thiophen-2-yl)methyl]benzamide
2-ethoxy-N-(4-methylphenyl)-N-[(thiophen-2-yl)methyl]benzamide
Compound characteristics
| Compound ID: | D339-0236 |
| Compound Name: | 2-ethoxy-N-(4-methylphenyl)-N-[(thiophen-2-yl)methyl]benzamide |
| Molecular Weight: | 351.47 |
| Molecular Formula: | C21 H21 N O2 S |
| Smiles: | CCOc1ccccc1C(N(Cc1cccs1)c1ccc(C)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1687 |
| logD: | 5.1687 |
| logSw: | -4.9382 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 23.8181 |
| InChI Key: | ZZMIQQQXKCFXNF-UHFFFAOYSA-N |