N-(4-methylphenyl)-3-nitro-N-[(thiophen-2-yl)methyl]benzamide
Chemical Structure Depiction of
N-(4-methylphenyl)-3-nitro-N-[(thiophen-2-yl)methyl]benzamide
N-(4-methylphenyl)-3-nitro-N-[(thiophen-2-yl)methyl]benzamide
Compound characteristics
| Compound ID: | D339-0240 |
| Compound Name: | N-(4-methylphenyl)-3-nitro-N-[(thiophen-2-yl)methyl]benzamide |
| Molecular Weight: | 352.41 |
| Molecular Formula: | C19 H16 N2 O3 S |
| Smiles: | Cc1ccc(cc1)N(Cc1cccs1)C(c1cccc(c1)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6477 |
| logD: | 4.6477 |
| logSw: | -4.4839 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 49.989 |
| InChI Key: | YSGHODAOKJRSIQ-UHFFFAOYSA-N |