5-bromo-3-methyl-N-(4-methylphenyl)-N-[(thiophen-2-yl)methyl]-1-benzofuran-2-carboxamide
Chemical Structure Depiction of
5-bromo-3-methyl-N-(4-methylphenyl)-N-[(thiophen-2-yl)methyl]-1-benzofuran-2-carboxamide
5-bromo-3-methyl-N-(4-methylphenyl)-N-[(thiophen-2-yl)methyl]-1-benzofuran-2-carboxamide
Compound characteristics
| Compound ID: | D339-0249 |
| Compound Name: | 5-bromo-3-methyl-N-(4-methylphenyl)-N-[(thiophen-2-yl)methyl]-1-benzofuran-2-carboxamide |
| Molecular Weight: | 440.36 |
| Molecular Formula: | C22 H18 Br N O2 S |
| Smiles: | Cc1ccc(cc1)N(Cc1cccs1)C(c1c(C)c2cc(ccc2o1)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 6.6669 |
| logD: | 6.6669 |
| logSw: | -5.5952 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 25.1337 |
| InChI Key: | LITGWLOUUJTVBR-UHFFFAOYSA-N |