2-butoxy-N-(4-methoxyphenyl)-N-[(thiophen-2-yl)methyl]benzamide
Chemical Structure Depiction of
2-butoxy-N-(4-methoxyphenyl)-N-[(thiophen-2-yl)methyl]benzamide
2-butoxy-N-(4-methoxyphenyl)-N-[(thiophen-2-yl)methyl]benzamide
Compound characteristics
| Compound ID: | D339-0317 |
| Compound Name: | 2-butoxy-N-(4-methoxyphenyl)-N-[(thiophen-2-yl)methyl]benzamide |
| Molecular Weight: | 395.52 |
| Molecular Formula: | C23 H25 N O3 S |
| Smiles: | CCCCOc1ccccc1C(N(Cc1cccs1)c1ccc(cc1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 5.8771 |
| logD: | 5.8771 |
| logSw: | -5.4845 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.656 |
| InChI Key: | ATBNPQNIKYWDND-UHFFFAOYSA-N |