N-[(2-fluorophenyl)methyl]-N'-phenyl-N-(pyridin-2-yl)urea
Chemical Structure Depiction of
N-[(2-fluorophenyl)methyl]-N'-phenyl-N-(pyridin-2-yl)urea
N-[(2-fluorophenyl)methyl]-N'-phenyl-N-(pyridin-2-yl)urea
Compound characteristics
| Compound ID: | D341-0709 |
| Compound Name: | N-[(2-fluorophenyl)methyl]-N'-phenyl-N-(pyridin-2-yl)urea |
| Molecular Weight: | 321.35 |
| Molecular Formula: | C19 H16 F N3 O |
| Smiles: | C(c1ccccc1F)N(C(Nc1ccccc1)=O)c1ccccn1 |
| Stereo: | ACHIRAL |
| logP: | 4.4223 |
| logD: | 4.422 |
| logSw: | -4.4212 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.922 |
| InChI Key: | QPGRWLVCJSYJHN-UHFFFAOYSA-N |