N-[(2-fluorophenyl)methyl]-4-(2-methylpropoxy)-N-(pyridin-2-yl)benzamide
Chemical Structure Depiction of
N-[(2-fluorophenyl)methyl]-4-(2-methylpropoxy)-N-(pyridin-2-yl)benzamide
N-[(2-fluorophenyl)methyl]-4-(2-methylpropoxy)-N-(pyridin-2-yl)benzamide
Compound characteristics
| Compound ID: | D341-0743 |
| Compound Name: | N-[(2-fluorophenyl)methyl]-4-(2-methylpropoxy)-N-(pyridin-2-yl)benzamide |
| Molecular Weight: | 378.45 |
| Molecular Formula: | C23 H23 F N2 O2 |
| Smiles: | CC(C)COc1ccc(cc1)C(N(Cc1ccccc1F)c1ccccn1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.514 |
| logD: | 5.514 |
| logSw: | -5.4629 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.5999 |
| InChI Key: | GJDSPYDJXCCFSV-UHFFFAOYSA-N |