N'-(3-chlorophenyl)-N-[(4-methylphenyl)methyl]-N-(pyridin-2-yl)urea
Chemical Structure Depiction of
N'-(3-chlorophenyl)-N-[(4-methylphenyl)methyl]-N-(pyridin-2-yl)urea
N'-(3-chlorophenyl)-N-[(4-methylphenyl)methyl]-N-(pyridin-2-yl)urea
Compound characteristics
| Compound ID: | D341-1031 |
| Compound Name: | N'-(3-chlorophenyl)-N-[(4-methylphenyl)methyl]-N-(pyridin-2-yl)urea |
| Molecular Weight: | 351.83 |
| Molecular Formula: | C20 H18 Cl N3 O |
| Smiles: | Cc1ccc(CN(C(Nc2cccc(c2)[Cl])=O)c2ccccn2)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.6505 |
| logD: | 5.6496 |
| logSw: | -5.7423 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.922 |
| InChI Key: | JDOBCJNATSZOPE-UHFFFAOYSA-N |