2-chloro-N-(pyridin-2-yl)-N-[(thiophen-2-yl)methyl]benzamide
Chemical Structure Depiction of
2-chloro-N-(pyridin-2-yl)-N-[(thiophen-2-yl)methyl]benzamide
2-chloro-N-(pyridin-2-yl)-N-[(thiophen-2-yl)methyl]benzamide
Compound characteristics
| Compound ID: | D341-1223 |
| Compound Name: | 2-chloro-N-(pyridin-2-yl)-N-[(thiophen-2-yl)methyl]benzamide |
| Molecular Weight: | 328.82 |
| Molecular Formula: | C17 H13 Cl N2 O S |
| Smiles: | C(c1cccs1)N(C(c1ccccc1[Cl])=O)c1ccccn1 |
| Stereo: | ACHIRAL |
| logP: | 4.2078 |
| logD: | 4.2077 |
| logSw: | -4.4647 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 25.1191 |
| InChI Key: | QLMMKRSVJDYOHU-UHFFFAOYSA-N |